C8H9NO5 — CID 126625937
methyl (7aR)-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 126625937) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is methyl (7aR)-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (7aR)-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 126625937 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | methyl (7aR)-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12COCN1C(=O)CC2=O |
| InChI | InChI=1S/C8H9NO5/c1-13-7(12)8-3-14-4-9(8)6(11)2-5(8)10/h2-4H2,1H3/t8-/m1/s1 |
| InChIKey | MEZGGXKCYUYMOM-MRVPVSSYSA-N |
| XLogP | -1.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|