About 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene
2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene (PubChem CID 126626429) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene.
Analyze 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
The IUPAC name of 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene (CID 126626429) is 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene.
What is the SMILES notation for 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
The canonical SMILES for 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene is CC(C)C1=NC=CC=C=N1.
What is the InChIKey of 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
The InChIKey is QWKUPPSWYAAZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-7(2)8-9-5-3-4-6-10-8/h3-5,7H,1-2H3.
What are the key properties of 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene has a molecular weight of 134.18 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene is sourced from PubChem (CID 126626429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).