About 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene
2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene (PubChem CID 126626557) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene.
Molecular Properties
| Compound Name | 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene |
| PubChem CID | 126626557 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene |
| SMILES | CC(C)C1=CN=C=CO1 |
| InChI | InChI=1S/C7H9NO/c1-6(2)7-5-8-3-4-9-7/h4-6H,1-2H3 |
| InChIKey | XIOROERFOSDVFX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene?
The IUPAC name of 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene (CID 126626557) is 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene.
What is the SMILES notation for 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene?
The canonical SMILES for 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene is CC(C)C1=CN=C=CO1.
What is the InChIKey of 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene?
The InChIKey is XIOROERFOSDVFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-6(2)7-5-8-3-4-9-7/h4-6H,1-2H3.
What are the key properties of 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene?
2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene has a molecular weight of 123.15 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1-oxa-4-azacyclohexa-2,4,5-triene is sourced from PubChem (CID 126626557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).