About N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine
N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine (PubChem CID 126626575) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine.
Molecular Properties
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine |
| PubChem CID | 126626575 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine |
| SMILES | C=C/C=C\N=C(/C=C)C(CCCCCC)CCCCCC |
| InChI | InChI=1S/C20H35N/c1-5-9-12-14-16-19(17-15-13-10-6-2)20(8-4)21-18-11-7-3/h7-8,11,18-19H,3-6,9-10,12-17H2,1-2H3/b18-11-,21-20+ |
| InChIKey | IDEUJEVHOMQEIR-HVEIJDALSA-N |
| XLogP | 6.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine?
The IUPAC name of N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine (CID 126626575) is N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine.
What is the SMILES notation for N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine?
The canonical SMILES for N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine is C=C/C=C\N=C(/C=C)C(CCCCCC)CCCCCC.
What is the InChIKey of N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine?
The InChIKey is IDEUJEVHOMQEIR-HVEIJDALSA-N. The full InChI is InChI=1S/C20H35N/c1-5-9-12-14-16-19(17-15-13-10-6-2)20(8-4)21-18-11-7-3/h7-8,11,18-19H,3-6,9-10,12-17H2,1-2H3/b18-11-,21-20+.
What are the key properties of N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine?
N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine has a molecular weight of 289.51 g/mol, XLogP of 6.87, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-buta-1,3-dienyl]-4-hexyldec-1-en-3-imine is sourced from PubChem (CID 126626575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).