About (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine
(Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine (PubChem CID 126626583) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine |
| PubChem CID | 126626583 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine |
| SMILES | C=CS/C(=C\NC)C(C)C |
| InChI | InChI=1S/C8H15NS/c1-5-10-8(6-9-4)7(2)3/h5-7,9H,1H2,2-4H3/b8-6- |
| InChIKey | GUDUFPOYAQXHLK-VURMDHGXSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine?
The IUPAC name of (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine (CID 126626583) is (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine.
What is the SMILES notation for (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine?
The canonical SMILES for (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine is C=CS/C(=C\NC)C(C)C.
What is the InChIKey of (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine?
The InChIKey is GUDUFPOYAQXHLK-VURMDHGXSA-N. The full InChI is InChI=1S/C8H15NS/c1-5-10-8(6-9-4)7(2)3/h5-7,9H,1H2,2-4H3/b8-6-.
What are the key properties of (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine?
(Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine has a molecular weight of 157.28 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-ethenylsulfanyl-N,3-dimethylbut-1-en-1-amine is sourced from PubChem (CID 126626583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).