C12H16O2 — CID 126626627
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxan-4-one (PubChem CID 126626627) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxan-4-one.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxan-4-one |
|---|---|
| PubChem CID | 126626627 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxan-4-one |
| SMILES | C=C/C=C\C(=C/C)C1COCCC1=O |
| InChI | InChI=1S/C12H16O2/c1-3-5-6-10(4-2)11-9-14-8-7-12(11)13/h3-6,11H,1,7-9H2,2H3/b6-5-,10-4+ |
| InChIKey | VZXLBJUGIVKTJU-QYONPMAVSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|