About (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde
(3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde (PubChem CID 126627046) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde |
| PubChem CID | 126627046 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde |
| SMILES | O=CC1=C/C(=N\O)C=CC1 |
| InChI | InChI=1S/C7H7NO2/c9-5-6-2-1-3-7(4-6)8-10/h1,3-5,10H,2H2/b8-7- |
| InChIKey | OTSXOOZASHDVTA-FPLPWBNLSA-N |
| XLogP | 0.90 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde?
The IUPAC name of (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde (CID 126627046) is (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde.
What is the SMILES notation for (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde?
The canonical SMILES for (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde is O=CC1=C/C(=N\O)C=CC1.
What is the InChIKey of (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde?
The InChIKey is OTSXOOZASHDVTA-FPLPWBNLSA-N. The full InChI is InChI=1S/C7H7NO2/c9-5-6-2-1-3-7(4-6)8-10/h1,3-5,10H,2H2/b8-7-.
What are the key properties of (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde?
(3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde has a molecular weight of 137.14 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-hydroxyiminocyclohexa-1,4-diene-1-carbaldehyde is sourced from PubChem (CID 126627046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).