About [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate
[5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate (PubChem CID 126627298) has the molecular formula C17H12BrF3N2O3S
and a molecular weight of 461.26 g/mol. Its IUPAC name is [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate.
Molecular Properties
| Compound Name | [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate |
| PubChem CID | 126627298 |
| Molecular Formula | C17H12BrF3N2O3S |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate |
| SMILES | CC(=O)c1c(C)cn2nc(-c3cccc(Br)c3)cc2c1OS(=O)C(F)(F)F |
| InChI | InChI=1S/C17H12BrF3N2O3S/c1-9-8-23-14(7-13(22-23)11-4-3-5-12(18)6-11)16(15(9)10(2)24)26-27(25)17(19,20)21/h3-8H,1-2H3 |
| InChIKey | FMRCYFOOQSHLSQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate?
The IUPAC name of [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate (CID 126627298) is [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate.
What is the SMILES notation for [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate?
The canonical SMILES for [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate is CC(=O)c1c(C)cn2nc(-c3cccc(Br)c3)cc2c1OS(=O)C(F)(F)F.
What is the InChIKey of [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate?
The InChIKey is FMRCYFOOQSHLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrF3N2O3S/c1-9-8-23-14(7-13(22-23)11-4-3-5-12(18)6-11)16(15(9)10(2)24)26-27(25)17(19,20)21/h3-8H,1-2H3.
What are the key properties of [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate?
[5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate has a molecular weight of 461.26 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-acetyl-2-(3-bromophenyl)-6-methylpyrazolo[1,5-a]pyridin-4-yl] trifluoromethanesulfinate is sourced from PubChem (CID 126627298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).