About 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol
2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol (PubChem CID 126627480) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol |
| PubChem CID | 126627480 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol |
| SMILES | C=CN(C/C=C\C=C/C)CCO |
| InChI | InChI=1S/C10H17NO/c1-3-5-6-7-8-11(4-2)9-10-12/h3-7,12H,2,8-10H2,1H3/b5-3-,7-6- |
| InChIKey | PWIARZXRUWPGAP-VKLRWAGZSA-N |
| XLogP | 1.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol?
The IUPAC name of 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol (CID 126627480) is 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol.
What is the SMILES notation for 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol?
The canonical SMILES for 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol is C=CN(C/C=C\C=C/C)CCO.
What is the InChIKey of 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol?
The InChIKey is PWIARZXRUWPGAP-VKLRWAGZSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-5-6-7-8-11(4-2)9-10-12/h3-7,12H,2,8-10H2,1H3/b5-3-,7-6-.
What are the key properties of 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol?
2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol has a molecular weight of 167.25 g/mol, XLogP of 1.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethenyl-[(2Z,4Z)-hexa-2,4-dienyl]amino]ethanol is sourced from PubChem (CID 126627480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).