C54H67NO — CID 126627534
3-[3-[9,9-dihexyl-7-(2-methylbutan-2-yl)fluoren-2-yl]-3-methylbutan-2-yl]-7-methyl-10-phenylphenoxazine (PubChem CID 126627534) has the molecular formula C54H67NO and a molecular weight of 746.14 g/mol. Its IUPAC name is 3-[3-[9,9-dihexyl-7-(2-methylbutan-2-yl)fluoren-2-yl]-3-methylbutan-2-yl]-7-methyl-10-phenylphenoxazine.
| Compound Name | 3-[3-[9,9-dihexyl-7-(2-methylbutan-2-yl)fluoren-2-yl]-3-methylbutan-2-yl]-7-methyl-10-phenylphenoxazine |
|---|---|
| PubChem CID | 126627534 |
| Molecular Formula | C54H67NO |
| Molecular Weight | 746.14 g/mol |
| Exact Mass | 745.52 |
| IUPAC Name | 3-[3-[9,9-dihexyl-7-(2-methylbutan-2-yl)fluoren-2-yl]-3-methylbutan-2-yl]-7-methyl-10-phenylphenoxazine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C(C)(C)CC)ccc2-c2ccc(C(C)(C)C(C)c3ccc4c(c3)Oc3cc(C)ccc3N4c3ccccc3)cc21 |
| InChI | InChI=1S/C54H67NO/c1-10-13-15-20-32-54(33-21-16-14-11-2)46-36-41(52(6,7)12-3)26-28-44(46)45-29-27-42(37-47(45)54)53(8,9)39(5)40-25-31-49-51(35-40)56-50-34-38(4)24-30-48(50)55(49)43-22-18-17-19-23-43/h17-19,22-31,34-37,39H,10-16,20-21,32-33H2,1-9H3 |
| InChIKey | XPEDAQHMASIKKJ-UHFFFAOYSA-N |
| XLogP | 16.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.14 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|