C18H24N6O2 — CID 126627684
4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-6-piperidin-1-ylpyridazine-3-carboxamide (PubChem CID 126627684) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-6-piperidin-1-ylpyridazine-3-carboxamide.
| Compound Name | 4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-6-piperidin-1-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126627684 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]-6-piperidin-1-ylpyridazine-3-carboxamide |
| SMILES | CC(C)(O)c1cccc(Nc2cc(N3CCCCC3)nnc2C(N)=O)n1 |
| InChI | InChI=1S/C18H24N6O2/c1-18(2,26)13-7-6-8-14(21-13)20-12-11-15(22-23-16(12)17(19)25)24-9-4-3-5-10-24/h6-8,11,26H,3-5,9-10H2,1-2H3,(H2,19,25)(H,20,21,22) |
| InChIKey | OHQXMRRZQUFQRU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |