C69H51N3 — CID 126627820
6-[4-(3-phenylphenyl)phenyl]-2,4-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 126627820) has the molecular formula C69H51N3 and a molecular weight of 922.19 g/mol. Its IUPAC name is 6-[4-(3-phenylphenyl)phenyl]-2,4-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 6-[4-(3-phenylphenyl)phenyl]-2,4-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 126627820 |
| Molecular Formula | C69H51N3 |
| Molecular Weight | 922.19 g/mol |
| Exact Mass | 921.41 |
| IUPAC Name | 6-[4-(3-phenylphenyl)phenyl]-2,4-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3ccc(C4=NC(c5ccc(-c6cccc(-c7cccc(-c8ccccc8)c7)c6)cc5)NC(c5ccc(-c6cccc(-c7cccc(-c8ccccc8)c7)c6)cc5)N4)cc3)c2)cc1 |
| InChI | InChI=1S/C69H51N3/c1-4-15-48(16-5-1)57-21-10-24-60(43-57)51-31-37-54(38-32-51)67-70-68(55-39-33-52(34-40-55)61-25-13-29-65(46-61)63-27-11-22-58(44-63)49-17-6-2-7-18-49)72-69(71-67)56-41-35-53(36-42-56)62-26-14-30-66(47-62)64-28-12-23-59(45-64)50-19-8-3-9-20-50/h1-47,68-69,72H,(H,70,71) |
| InChIKey | GFEKZRVQGOESIU-UHFFFAOYSA-N |
| XLogP | 17.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.19 |
| LogP ≤ 5 | 17.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |