C24H40O4 — CID 126627871
3-(2,5-ditert-butyl-4-methoxyphenoxy)propyl 2,2-dimethylbutanoate (PubChem CID 126627871) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is 3-(2,5-ditert-butyl-4-methoxyphenoxy)propyl 2,2-dimethylbutanoate.
| Compound Name | 3-(2,5-ditert-butyl-4-methoxyphenoxy)propyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 126627871 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 3-(2,5-ditert-butyl-4-methoxyphenoxy)propyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCOc1cc(C(C)(C)C)c(OC)cc1C(C)(C)C |
| InChI | InChI=1S/C24H40O4/c1-11-24(8,9)21(25)28-14-12-13-27-20-16-17(22(2,3)4)19(26-10)15-18(20)23(5,6)7/h15-16H,11-14H2,1-10H3 |
| InChIKey | KSEQISHPNHVMIR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|