C24H30Cl2F2N4O4 — CID 126627878
[(2R,3S)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 126627878) has the molecular formula C24H30Cl2F2N4O4 and a molecular weight of 547.43 g/mol. Its IUPAC name is [(2R,3S)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
| Compound Name | [(2R,3S)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 126627878 |
| Molecular Formula | C24H30Cl2F2N4O4 |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [(2R,3S)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | C=C1N=C(N)C=CN1C1O[C@H](COC(=O)CCCc2ccc(N(CCCl)CCCl)cc2)[C@H](O)C1(F)F |
| InChI | InChI=1S/C24H30Cl2F2N4O4/c1-16-30-20(29)9-12-32(16)23-24(27,28)22(34)19(36-23)15-35-21(33)4-2-3-17-5-7-18(8-6-17)31(13-10-25)14-11-26/h5-9,12,19,22-23,34H,1-4,10-11,13-15H2,(H2,29,30)/t19-,22+,23?/m1/s1 |
| InChIKey | IFSFOPXDRQYKFR-BSJAROSPSA-N |
| XLogP | 3.22 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|