C69H53N3 — CID 126628180
2-[4-(3-phenylphenyl)cyclohexa-2,4-dien-1-yl]-4,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 126628180) has the molecular formula C69H53N3 and a molecular weight of 924.20 g/mol. Its IUPAC name is 2-[4-(3-phenylphenyl)cyclohexa-2,4-dien-1-yl]-4,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 2-[4-(3-phenylphenyl)cyclohexa-2,4-dien-1-yl]-4,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 126628180 |
| Molecular Formula | C69H53N3 |
| Molecular Weight | 924.20 g/mol |
| Exact Mass | 923.42 |
| IUPAC Name | 2-[4-(3-phenylphenyl)cyclohexa-2,4-dien-1-yl]-4,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | C1=CC(C2NC(c3ccc(-c4cccc(-c5cccc(-c6ccccc6)c5)c4)cc3)=NC(c3ccc(-c4cccc(-c5cccc(-c6ccccc6)c5)c4)cc3)N2)CC=C1c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C69H53N3/c1-4-15-48(16-5-1)57-21-10-24-60(43-57)51-31-37-54(38-32-51)67-70-68(55-39-33-52(34-40-55)61-25-13-29-65(46-61)63-27-11-22-58(44-63)49-17-6-2-7-18-49)72-69(71-67)56-41-35-53(36-42-56)62-26-14-30-66(47-62)64-28-12-23-59(45-64)50-19-8-3-9-20-50/h1-37,39-47,54,67-68,70H,38H2,(H,71,72) |
| InChIKey | KGDUXTNSFYLBDD-UHFFFAOYSA-N |
| XLogP | 16.98 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.20 |
| LogP ≤ 5 | 16.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |