C63H47N3 — CID 126628186
4-(3-phenylphenyl)-2,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 126628186) has the molecular formula C63H47N3 and a molecular weight of 846.09 g/mol. Its IUPAC name is 4-(3-phenylphenyl)-2,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 4-(3-phenylphenyl)-2,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 126628186 |
| Molecular Formula | C63H47N3 |
| Molecular Weight | 846.09 g/mol |
| Exact Mass | 845.38 |
| IUPAC Name | 4-(3-phenylphenyl)-2,6-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3cccc(-c4ccc(C5=NC(c6cccc(-c7ccccc7)c6)NC(c6ccc(-c7cccc(-c8cccc(-c9ccccc9)c8)c7)cc6)N5)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C63H47N3/c1-4-15-44(16-5-1)51-21-10-26-56(39-51)58-28-12-23-53(41-58)47-31-35-49(36-32-47)61-64-62(66-63(65-61)60-30-14-25-55(43-60)46-19-8-3-9-20-46)50-37-33-48(34-38-50)54-24-13-29-59(42-54)57-27-11-22-52(40-57)45-17-6-2-7-18-45/h1-43,61,63,65H,(H,64,66) |
| InChIKey | IGFAFDPEDPJHCE-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.09 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |