C15H18O4 — CID 126628289
methyl (2Z,4E)-5-[(1R,6S)-2,6-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-1-yl]-3-methylpenta-2,4-dienoate (PubChem CID 126628289) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl (2Z,4E)-5-[(1R,6S)-2,6-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-1-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-[(1R,6S)-2,6-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-1-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 126628289 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl (2Z,4E)-5-[(1R,6S)-2,6-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-1-yl]-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)\C=C\[C@]12O[C@@]1(C)CC(=O)C=C2C |
| InChI | InChI=1S/C15H18O4/c1-10(7-13(17)18-4)5-6-15-11(2)8-12(16)9-14(15,3)19-15/h5-8H,9H2,1-4H3/b6-5+,10-7-/t14-,15+/m0/s1 |
| InChIKey | WHIJJIIAVIOFBU-APERQWQTSA-N |
| XLogP | 2.11 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|