C16H20F4N2 — CID 126628751
1-N,4-N-bis(but-3-enyl)-2,3,5,6-tetrafluoro-1-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 126628751) has the molecular formula C16H20F4N2 and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-N,4-N-bis(but-3-enyl)-2,3,5,6-tetrafluoro-1-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(but-3-enyl)-2,3,5,6-tetrafluoro-1-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 126628751 |
| Molecular Formula | C16H20F4N2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-N,4-N-bis(but-3-enyl)-2,3,5,6-tetrafluoro-1-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | C=CCCN(C)c1c(F)c(F)c(N(C)CCC=C)c(F)c1F |
| InChI | InChI=1S/C16H20F4N2/c1-5-7-9-21(3)15-11(17)13(19)16(14(20)12(15)18)22(4)10-8-6-2/h5-6H,1-2,7-10H2,3-4H3 |
| InChIKey | TXZXEZLUJLTFST-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|