C27H35N5O5 — CID 126629055
[(1R)-1-(7-ethenylquinolin-2-yl)ethyl] 1-[2-[(2-formamido-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate (PubChem CID 126629055) has the molecular formula C27H35N5O5 and a molecular weight of 509.61 g/mol. Its IUPAC name is [(1R)-1-(7-ethenylquinolin-2-yl)ethyl] 1-[2-[(2-formamido-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | [(1R)-1-(7-ethenylquinolin-2-yl)ethyl] 1-[2-[(2-formamido-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 126629055 |
| Molecular Formula | C27H35N5O5 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | [(1R)-1-(7-ethenylquinolin-2-yl)ethyl] 1-[2-[(2-formamido-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate |
| SMILES | C=Cc1ccc2ccc([C@@H](C)OC(=O)C3CCCN(C(=O)C(C)NC(=O)C(NC=O)C(C)C)N3)nc2c1 |
| InChI | InChI=1S/C27H35N5O5/c1-6-19-9-10-20-11-12-21(30-23(20)14-19)18(5)37-27(36)22-8-7-13-32(31-22)26(35)17(4)29-25(34)24(16(2)3)28-15-33/h6,9-12,14-18,22,24,31H,1,7-8,13H2,2-5H3,(H,28,33)(H,29,34)/t17?,18-,22?,24?/m1/s1 |
| InChIKey | OJRYJBHPZZNNLB-PTIWNWLESA-N |
| XLogP | 2.25 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|