C25H25FN2O4 — CID 126629290
2-(cyclopropylmethoxy)-N-[(3-fluoro-4-methylphenyl)methyl]-5-[4-(hydroxymethyl)-1-oxidopyridin-1-ium-3-yl]benzamide (PubChem CID 126629290) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-N-[(3-fluoro-4-methylphenyl)methyl]-5-[4-(hydroxymethyl)-1-oxidopyridin-1-ium-3-yl]benzamide.
| Compound Name | 2-(cyclopropylmethoxy)-N-[(3-fluoro-4-methylphenyl)methyl]-5-[4-(hydroxymethyl)-1-oxidopyridin-1-ium-3-yl]benzamide |
|---|---|
| PubChem CID | 126629290 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-(cyclopropylmethoxy)-N-[(3-fluoro-4-methylphenyl)methyl]-5-[4-(hydroxymethyl)-1-oxidopyridin-1-ium-3-yl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2cc(-c3c[n+]([O-])ccc3CO)ccc2OCC2CC2)cc1F |
| InChI | InChI=1S/C25H25FN2O4/c1-16-2-3-18(10-23(16)26)12-27-25(30)21-11-19(6-7-24(21)32-15-17-4-5-17)22-13-28(31)9-8-20(22)14-29/h2-3,6-11,13,17,29H,4-5,12,14-15H2,1H3,(H,27,30) |
| InChIKey | LFSJGGLVIMRPCT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|