About 1,2-dimethyl-2,5-dihydropyridin-6-one
1,2-dimethyl-2,5-dihydropyridin-6-one (PubChem CID 12662946) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,2-dimethyl-2,5-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1,2-dimethyl-2,5-dihydropyridin-6-one |
| PubChem CID | 12662946 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 1,2-dimethyl-2,5-dihydropyridin-6-one |
| SMILES | CC1C=CCC(=O)N1C |
| InChI | InChI=1S/C7H11NO/c1-6-4-3-5-7(9)8(6)2/h3-4,6H,5H2,1-2H3 |
| InChIKey | NYUUMBHFIFTLCR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-2,5-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-2,5-dihydropyridin-6-one?
The IUPAC name of 1,2-dimethyl-2,5-dihydropyridin-6-one (CID 12662946) is 1,2-dimethyl-2,5-dihydropyridin-6-one.
What is the SMILES notation for 1,2-dimethyl-2,5-dihydropyridin-6-one?
The canonical SMILES for 1,2-dimethyl-2,5-dihydropyridin-6-one is CC1C=CCC(=O)N1C.
What is the InChIKey of 1,2-dimethyl-2,5-dihydropyridin-6-one?
The InChIKey is NYUUMBHFIFTLCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-6-4-3-5-7(9)8(6)2/h3-4,6H,5H2,1-2H3.
What are the key properties of 1,2-dimethyl-2,5-dihydropyridin-6-one?
1,2-dimethyl-2,5-dihydropyridin-6-one has a molecular weight of 125.17 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-2,5-dihydropyridin-6-one is sourced from PubChem (CID 12662946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).