C10H16N2 — CID 126629494
(7R)-1,5,7-trimethyl-3a,4,7,7a-tetrahydroindazole (PubChem CID 126629494) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (7R)-1,5,7-trimethyl-3a,4,7,7a-tetrahydroindazole.
| Compound Name | (7R)-1,5,7-trimethyl-3a,4,7,7a-tetrahydroindazole |
|---|---|
| PubChem CID | 126629494 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (7R)-1,5,7-trimethyl-3a,4,7,7a-tetrahydroindazole |
| SMILES | CC1=C[C@@H](C)C2C(C=NN2C)C1 |
| InChI | InChI=1S/C10H16N2/c1-7-4-8(2)10-9(5-7)6-11-12(10)3/h4,6,8-10H,5H2,1-3H3/t8-,9?,10?/m1/s1 |
| InChIKey | KDFNTEUVSGKVHL-XNWIYYODSA-N |
| XLogP | 1.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|