C9H19BrO2 — CID 126629923
3-[(3R)-3-bromobutan-2-yl]oxy-2,2-dimethylpropan-1-ol (PubChem CID 126629923) has the molecular formula C9H19BrO2 and a molecular weight of 239.15 g/mol. Its IUPAC name is 3-[(3R)-3-bromobutan-2-yl]oxy-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[(3R)-3-bromobutan-2-yl]oxy-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 126629923 |
| Molecular Formula | C9H19BrO2 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-[(3R)-3-bromobutan-2-yl]oxy-2,2-dimethylpropan-1-ol |
| SMILES | CC(OCC(C)(C)CO)[C@@H](C)Br |
| InChI | InChI=1S/C9H19BrO2/c1-7(10)8(2)12-6-9(3,4)5-11/h7-8,11H,5-6H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | ZTDRDZZVKHRYSW-GVHYBUMESA-N |
| XLogP | 2.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|