C9H10F3N — CID 126629925
(4Z,6E)-1,1,1-trifluoronona-4,6,8-trien-3-imine (PubChem CID 126629925) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is (4Z,6E)-1,1,1-trifluoronona-4,6,8-trien-3-imine.
| Compound Name | (4Z,6E)-1,1,1-trifluoronona-4,6,8-trien-3-imine |
|---|---|
| PubChem CID | 126629925 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (4Z,6E)-1,1,1-trifluoronona-4,6,8-trien-3-imine |
| SMILES | [H]/N=C(\C=C/C=C/C=C)CC(F)(F)F |
| InChI | InChI=1S/C9H10F3N/c1-2-3-4-5-6-8(13)7-9(10,11)12/h2-6,13H,1,7H2/b4-3+,6-5-,13-8+ |
| InChIKey | POYBEXINPSACPW-BHLSRYIYSA-N |
| XLogP | 3.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|