About 3-fluoro-3-iodooxetane
3-fluoro-3-iodooxetane (PubChem CID 126629928) has the molecular formula C3H4FIO
and a molecular weight of 201.97 g/mol. Its IUPAC name is 3-fluoro-3-iodooxetane.
Molecular Properties
| Compound Name | 3-fluoro-3-iodooxetane |
| PubChem CID | 126629928 |
| Molecular Formula | C3H4FIO |
| Molecular Weight | 201.97 g/mol |
| Exact Mass | 201.93 |
| IUPAC Name | 3-fluoro-3-iodooxetane |
| SMILES | FC1(I)COC1 |
| InChI | InChI=1S/C3H4FIO/c4-3(5)1-6-2-3/h1-2H2 |
| InChIKey | GTKMCTOXAKMUBU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.97 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-3-iodooxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-iodooxetane?
The IUPAC name of 3-fluoro-3-iodooxetane (CID 126629928) is 3-fluoro-3-iodooxetane.
What is the SMILES notation for 3-fluoro-3-iodooxetane?
The canonical SMILES for 3-fluoro-3-iodooxetane is FC1(I)COC1.
What is the InChIKey of 3-fluoro-3-iodooxetane?
The InChIKey is GTKMCTOXAKMUBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4FIO/c4-3(5)1-6-2-3/h1-2H2.
What are the key properties of 3-fluoro-3-iodooxetane?
3-fluoro-3-iodooxetane has a molecular weight of 201.97 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-iodooxetane is sourced from PubChem (CID 126629928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).