C42H31N — CID 126630309
N-(4-buta-1,3-diynylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-N-[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline (PubChem CID 126630309) has the molecular formula C42H31N and a molecular weight of 549.72 g/mol. Its IUPAC name is N-(4-buta-1,3-diynylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-N-[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline.
| Compound Name | N-(4-buta-1,3-diynylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-N-[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline |
|---|---|
| PubChem CID | 126630309 |
| Molecular Formula | C42H31N |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | N-(4-buta-1,3-diynylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-N-[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]aniline |
| SMILES | C#CC#Cc1ccc(N(c2ccc(/C=C/C=C/c3ccccc3)cc2)c2ccc(/C=C/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C42H31N/c1-2-3-14-37-23-29-40(30-24-37)43(41-31-25-38(26-32-41)21-12-10-19-35-15-6-4-7-16-35)42-33-27-39(28-34-42)22-13-11-20-36-17-8-5-9-18-36/h1,4-13,15-34H/b19-10+,20-11+,21-12+,22-13+ |
| InChIKey | KYLSYRVXPKLCRC-XDBRDGRUSA-N |
| XLogP | 10.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|