C18H19N — CID 126630598
(2R,3Z,13Z)-3-ethylidene-11-methyl-15-methylidene-10-azatricyclo[7.6.0.02,8]pentadeca-4,6,8,10,13-pentaene (PubChem CID 126630598) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is (2R,3Z,13Z)-3-ethylidene-11-methyl-15-methylidene-10-azatricyclo[7.6.0.02,8]pentadeca-4,6,8,10,13-pentaene.
| Compound Name | (2R,3Z,13Z)-3-ethylidene-11-methyl-15-methylidene-10-azatricyclo[7.6.0.02,8]pentadeca-4,6,8,10,13-pentaene |
|---|---|
| PubChem CID | 126630598 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2R,3Z,13Z)-3-ethylidene-11-methyl-15-methylidene-10-azatricyclo[7.6.0.02,8]pentadeca-4,6,8,10,13-pentaene |
| SMILES | C=C1/C=C\C/C(C)=N\C2=C3C=CC=C/C(=C/C)[C@H]3C12 |
| InChI | InChI=1S/C18H19N/c1-4-14-10-5-6-11-15-17(14)16-12(2)8-7-9-13(3)19-18(15)16/h4-8,10-11,16-17H,2,9H2,1,3H3/b8-7-,14-4-,19-13-/t16?,17-/m1/s1 |
| InChIKey | YNAFEAVIUZUQMX-AWKRYSKYSA-N |
| XLogP | 4.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |