About 2-chloro-10a,10b-dihydrobenzo[h]quinoline
2-chloro-10a,10b-dihydrobenzo[h]quinoline (PubChem CID 126631500) has the molecular formula C13H10ClN
and a molecular weight of 215.68 g/mol. Its IUPAC name is 2-chloro-10a,10b-dihydrobenzo[h]quinoline.
Molecular Properties
| Compound Name | 2-chloro-10a,10b-dihydrobenzo[h]quinoline |
| PubChem CID | 126631500 |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-chloro-10a,10b-dihydrobenzo[h]quinoline |
| SMILES | ClC1=NC2C(=CC=C3C=CC=CC32)C=C1 |
| InChI | InChI=1S/C13H10ClN/c14-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15-12/h1-8,11,13H |
| InChIKey | QEJZQNUFMMLCIB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-10a,10b-dihydrobenzo[h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-10a,10b-dihydrobenzo[h]quinoline?
The IUPAC name of 2-chloro-10a,10b-dihydrobenzo[h]quinoline (CID 126631500) is 2-chloro-10a,10b-dihydrobenzo[h]quinoline.
What is the SMILES notation for 2-chloro-10a,10b-dihydrobenzo[h]quinoline?
The canonical SMILES for 2-chloro-10a,10b-dihydrobenzo[h]quinoline is ClC1=NC2C(=CC=C3C=CC=CC32)C=C1.
What is the InChIKey of 2-chloro-10a,10b-dihydrobenzo[h]quinoline?
The InChIKey is QEJZQNUFMMLCIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN/c14-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15-12/h1-8,11,13H.
What are the key properties of 2-chloro-10a,10b-dihydrobenzo[h]quinoline?
2-chloro-10a,10b-dihydrobenzo[h]quinoline has a molecular weight of 215.68 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-10a,10b-dihydrobenzo[h]quinoline is sourced from PubChem (CID 126631500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).