About [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate
[4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate (PubChem CID 126633243) has the molecular formula C38H32O9
and a molecular weight of 632.67 g/mol. Its IUPAC name is [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate |
| PubChem CID | 126633243 |
| Molecular Formula | C38H32O9 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(CCc3cc(OC(=O)c4ccc(OC)cc4)cc(OC(=O)c4ccc(OC)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C38H32O9/c1-42-30-16-8-27(9-17-30)36(39)45-33-14-6-25(7-15-33)4-5-26-22-34(46-37(40)28-10-18-31(43-2)19-11-28)24-35(23-26)47-38(41)29-12-20-32(44-3)21-13-29/h6-24H,4-5H2,1-3H3 |
| InChIKey | ANDWNSKRDUOGAM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate?
The IUPAC name of [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate (CID 126633243) is [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate.
What is the SMILES notation for [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate?
The canonical SMILES for [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate is COc1ccc(C(=O)Oc2ccc(CCc3cc(OC(=O)c4ccc(OC)cc4)cc(OC(=O)c4ccc(OC)cc4)c3)cc2)cc1.
What is the InChIKey of [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate?
The InChIKey is ANDWNSKRDUOGAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H32O9/c1-42-30-16-8-27(9-17-30)36(39)45-33-14-6-25(7-15-33)4-5-26-22-34(46-37(40)28-10-18-31(43-2)19-11-28)24-35(23-26)47-38(41)29-12-20-32(44-3)21-13-29/h6-24H,4-5H2,1-3H3.
What are the key properties of [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate?
[4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate has a molecular weight of 632.67 g/mol, XLogP of 7.16, 12 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[3,5-bis[(4-methoxybenzoyl)oxy]phenyl]ethyl]phenyl] 4-methoxybenzoate is sourced from PubChem (CID 126633243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).