C14H25N3 — CID 126633518
(2Z,5E)-3-methyl-6-[2-[[(1Z)-2-methylbuta-1,3-dienyl]amino]hydrazinyl]octa-2,5-diene (PubChem CID 126633518) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (2Z,5E)-3-methyl-6-[2-[[(1Z)-2-methylbuta-1,3-dienyl]amino]hydrazinyl]octa-2,5-diene.
| Compound Name | (2Z,5E)-3-methyl-6-[2-[[(1Z)-2-methylbuta-1,3-dienyl]amino]hydrazinyl]octa-2,5-diene |
|---|---|
| PubChem CID | 126633518 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (2Z,5E)-3-methyl-6-[2-[[(1Z)-2-methylbuta-1,3-dienyl]amino]hydrazinyl]octa-2,5-diene |
| SMILES | C=C/C(C)=C\NNN/C(=C/C/C(C)=C\C)CC |
| InChI | InChI=1S/C14H25N3/c1-6-12(4)9-10-14(8-3)16-17-15-11-13(5)7-2/h6-7,10-11,15-17H,2,8-9H2,1,3-5H3/b12-6-,13-11-,14-10+ |
| InChIKey | DCLAEUSOQVHANT-OLRXCLAHSA-N |
| XLogP | 3.33 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|