C16H33N — CID 126633661
(E)-N,N,4,4,7,8,8-heptamethylnon-6-en-1-amine (PubChem CID 126633661) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is (E)-N,N,4,4,7,8,8-heptamethylnon-6-en-1-amine.
| Compound Name | (E)-N,N,4,4,7,8,8-heptamethylnon-6-en-1-amine |
|---|---|
| PubChem CID | 126633661 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | (E)-N,N,4,4,7,8,8-heptamethylnon-6-en-1-amine |
| SMILES | C/C(=C\CC(C)(C)CCCN(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H33N/c1-14(15(2,3)4)10-12-16(5,6)11-9-13-17(7)8/h10H,9,11-13H2,1-8H3/b14-10+ |
| InChIKey | WJMFEBPFWDVYAS-GXDHUFHOSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|