C12H14BrFO — CID 126633716
(2E,4E,7Z)-2-bromo-7-ethenoxy-4-fluoro-6-methylidenenona-2,4,7-triene (PubChem CID 126633716) has the molecular formula C12H14BrFO and a molecular weight of 273.15 g/mol. Its IUPAC name is (2E,4E,7Z)-2-bromo-7-ethenoxy-4-fluoro-6-methylidenenona-2,4,7-triene.
| Compound Name | (2E,4E,7Z)-2-bromo-7-ethenoxy-4-fluoro-6-methylidenenona-2,4,7-triene |
|---|---|
| PubChem CID | 126633716 |
| Molecular Formula | C12H14BrFO |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (2E,4E,7Z)-2-bromo-7-ethenoxy-4-fluoro-6-methylidenenona-2,4,7-triene |
| SMILES | C=CO/C(=C\C)C(=C)/C=C(F)\C=C(/C)Br |
| InChI | InChI=1S/C12H14BrFO/c1-5-12(15-6-2)9(3)7-11(14)8-10(4)13/h5-8H,2-3H2,1,4H3/b10-8+,11-7+,12-5- |
| InChIKey | XTUVOSVBTRSYHK-RYVBEWDQSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|