C11H14FN2O2PS — CID 126633718
3-(2-fluoro-4-phosphanylphenyl)-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine (PubChem CID 126633718) has the molecular formula C11H14FN2O2PS and a molecular weight of 288.28 g/mol. Its IUPAC name is 3-(2-fluoro-4-phosphanylphenyl)-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine.
| Compound Name | 3-(2-fluoro-4-phosphanylphenyl)-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 126633718 |
| Molecular Formula | C11H14FN2O2PS |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-(2-fluoro-4-phosphanylphenyl)-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine |
| SMILES | CC1C(N)=NC(c2ccc(P)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C11H14FN2O2PS/c1-6-11(13)14-10(5-18(6,15)16)8-3-2-7(17)4-9(8)12/h2-4,6,10H,5,17H2,1H3,(H2,13,14) |
| InChIKey | NVDFVLBCZFNRTR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|