C25H29Cl2N3O2 — CID 126634198
1-[(4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]-3-(2,3-dichlorophenyl)urea (PubChem CID 126634198) has the molecular formula C25H29Cl2N3O2 and a molecular weight of 474.43 g/mol. Its IUPAC name is 1-[(4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[(4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 126634198 |
| Molecular Formula | C25H29Cl2N3O2 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-[(4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]-3-(2,3-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc2c(c1)C1OCCC[C@H]1[C@@H](C1CCCCC1)N2)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C25H29Cl2N3O2/c26-19-9-4-10-21(22(19)27)30-25(31)28-16-11-12-20-18(14-16)24-17(8-5-13-32-24)23(29-20)15-6-2-1-3-7-15/h4,9-12,14-15,17,23-24,29H,1-3,5-8,13H2,(H2,28,30,31)/t17-,23+,24?/m0/s1 |
| InChIKey | MNLYICLNJQDUKG-HDTCWFHRSA-N |
| XLogP | 7.48 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |