About 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene
3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene (PubChem CID 12663425) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene |
| PubChem CID | 12663425 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene |
| SMILES | C=C(C)C(CC=C(C)C)COC |
| InChI | InChI=1S/C11H20O/c1-9(2)6-7-11(8-12-5)10(3)4/h6,11H,3,7-8H2,1-2,4-5H3 |
| InChIKey | OEVGHYRSZABMFG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene?
The IUPAC name of 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene (CID 12663425) is 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene.
What is the SMILES notation for 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene?
The canonical SMILES for 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene is C=C(C)C(CC=C(C)C)COC.
What is the InChIKey of 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene?
The InChIKey is OEVGHYRSZABMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-9(2)6-7-11(8-12-5)10(3)4/h6,11H,3,7-8H2,1-2,4-5H3.
What are the key properties of 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene?
3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene has a molecular weight of 168.28 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-2,6-dimethylhepta-1,5-diene is sourced from PubChem (CID 12663425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).