C28H28O5 — CID 126634467
[4-[4-[(2E)-1-hydroxy-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]phenoxy]phenyl] (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate (PubChem CID 126634467) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is [4-[4-[(2E)-1-hydroxy-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]phenoxy]phenyl] (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate.
| Compound Name | [4-[4-[(2E)-1-hydroxy-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]phenoxy]phenyl] (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 126634467 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [4-[4-[(2E)-1-hydroxy-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]phenoxy]phenyl] (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate |
| SMILES | C=C/C=C(\C=C/C)C(=O)Oc1ccc(Oc2ccc(OC(O)C(/C=C\C)=C/C=C)cc2)cc1 |
| InChI | InChI=1S/C28H28O5/c1-5-9-21(10-6-2)27(29)32-25-17-13-23(14-18-25)31-24-15-19-26(20-16-24)33-28(30)22(11-7-3)12-8-4/h5-20,27,29H,1,3H2,2,4H3/b10-6-,12-8-,21-9+,22-11+ |
| InChIKey | YKUHAXHNYIXTAA-KWPHCCJUSA-N |
| XLogP | 6.46 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|