C20H23N — CID 126634784
(7S)-1-(2-cyclobut-2-en-1-ylcyclohexa-1,3-dien-1-yl)-7-methyl-4a,7,8,8a-tetrahydroisoquinoline (PubChem CID 126634784) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (7S)-1-(2-cyclobut-2-en-1-ylcyclohexa-1,3-dien-1-yl)-7-methyl-4a,7,8,8a-tetrahydroisoquinoline.
| Compound Name | (7S)-1-(2-cyclobut-2-en-1-ylcyclohexa-1,3-dien-1-yl)-7-methyl-4a,7,8,8a-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 126634784 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (7S)-1-(2-cyclobut-2-en-1-ylcyclohexa-1,3-dien-1-yl)-7-methyl-4a,7,8,8a-tetrahydroisoquinoline |
| SMILES | C[C@@H]1C=CC2C=CN=C(C3=C(C4C=CC4)C=CCC3)C2C1 |
| InChI | InChI=1S/C20H23N/c1-14-9-10-16-11-12-21-20(19(16)13-14)18-8-3-2-7-17(18)15-5-4-6-15/h2,4-5,7,9-12,14-16,19H,3,6,8,13H2,1H3/t14-,15?,16?,19?/m1/s1 |
| InChIKey | AXSRLWDFIUEUOF-XYLATYTLSA-N |
| XLogP | 5.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|