About [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea
[(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea (PubChem CID 126634847) has the molecular formula C7H13N3S
and a molecular weight of 171.27 g/mol. Its IUPAC name is [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea.
Molecular Properties
| Compound Name | [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea |
| PubChem CID | 126634847 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea |
| SMILES | CC(/C=C\C=C/N)NC(N)=S |
| InChI | InChI=1S/C7H13N3S/c1-6(10-7(9)11)4-2-3-5-8/h2-6H,8H2,1H3,(H3,9,10,11)/b4-2-,5-3- |
| InChIKey | ZUGAVRBAXCDIQF-JVLMNHKTSA-N |
| XLogP | 0.24 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea?
The IUPAC name of [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea (CID 126634847) is [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea.
What is the SMILES notation for [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea?
The canonical SMILES for [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea is CC(/C=C\C=C/N)NC(N)=S.
What is the InChIKey of [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea?
The InChIKey is ZUGAVRBAXCDIQF-JVLMNHKTSA-N. The full InChI is InChI=1S/C7H13N3S/c1-6(10-7(9)11)4-2-3-5-8/h2-6H,8H2,1H3,(H3,9,10,11)/b4-2-,5-3-.
What are the key properties of [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea?
[(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea has a molecular weight of 171.27 g/mol, XLogP of 0.24, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5Z)-6-aminohexa-3,5-dien-2-yl]thiourea is sourced from PubChem (CID 126634847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).