About 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine
4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine (PubChem CID 126635010) has the molecular formula C9H16FN3
and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine |
| PubChem CID | 126635010 |
| Molecular Formula | C9H16FN3 |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine |
| SMILES | CN(CCF)C1=CC(N)N(C)C=C1 |
| InChI | InChI=1S/C9H16FN3/c1-12(6-4-10)8-3-5-13(2)9(11)7-8/h3,5,7,9H,4,6,11H2,1-2H3 |
| InChIKey | MDBVQLMIGNJAPW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine?
The IUPAC name of 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine (CID 126635010) is 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine.
What is the SMILES notation for 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine?
The canonical SMILES for 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine is CN(CCF)C1=CC(N)N(C)C=C1.
What is the InChIKey of 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine?
The InChIKey is MDBVQLMIGNJAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FN3/c1-12(6-4-10)8-3-5-13(2)9(11)7-8/h3,5,7,9H,4,6,11H2,1-2H3.
What are the key properties of 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine?
4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine has a molecular weight of 185.25 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-fluoroethyl)-4-N,1-dimethyl-2H-pyridine-2,4-diamine is sourced from PubChem (CID 126635010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).