About [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol
[4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol (PubChem CID 126635020) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol |
| PubChem CID | 126635020 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol |
| SMILES | C/C=C\C(C)=C/C(C)=N/C(=C\C)c1ccc(CO)cc1 |
| InChI | InChI=1S/C18H23NO/c1-5-7-14(3)12-15(4)19-18(6-2)17-10-8-16(13-20)9-11-17/h5-12,20H,13H2,1-4H3/b7-5-,14-12-,18-6-,19-15+ |
| InChIKey | QKFVKAGZJUAANW-HUUQRBKNSA-N |
| XLogP | 4.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol?
The IUPAC name of [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol (CID 126635020) is [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol.
What is the SMILES notation for [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol?
The canonical SMILES for [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol is C/C=C\C(C)=C/C(C)=N/C(=C\C)c1ccc(CO)cc1.
What is the InChIKey of [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol?
The InChIKey is QKFVKAGZJUAANW-HUUQRBKNSA-N. The full InChI is InChI=1S/C18H23NO/c1-5-7-14(3)12-15(4)19-18(6-2)17-10-8-16(13-20)9-11-17/h5-12,20H,13H2,1-4H3/b7-5-,14-12-,18-6-,19-15+.
What are the key properties of [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol?
[4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol has a molecular weight of 269.39 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(Z)-1-[[(3Z,5Z)-4-methylhepta-3,5-dien-2-ylidene]amino]prop-1-enyl]phenyl]methanol is sourced from PubChem (CID 126635020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).