About (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene
(1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene (PubChem CID 126635593) has the molecular formula C12H20O2S
and a molecular weight of 228.36 g/mol. Its IUPAC name is (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene.
Molecular Properties
| Compound Name | (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene |
| PubChem CID | 126635593 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene |
| SMILES | C/C1=C/CC/C=C(/S(C)(=O)=O)CCCC1 |
| InChI | InChI=1S/C12H20O2S/c1-11-7-3-5-9-12(15(2,13)14)10-6-4-8-11/h7,9H,3-6,8,10H2,1-2H3/b11-7-,12-9+ |
| InChIKey | GTRBCFNJIBOENJ-VNPQWULESA-N |
| XLogP | 3.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene?
The IUPAC name of (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene (CID 126635593) is (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene.
What is the SMILES notation for (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene?
The canonical SMILES for (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene is C/C1=C/CC/C=C(/S(C)(=O)=O)CCCC1.
What is the InChIKey of (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene?
The InChIKey is GTRBCFNJIBOENJ-VNPQWULESA-N. The full InChI is InChI=1S/C12H20O2S/c1-11-7-3-5-9-12(15(2,13)14)10-6-4-8-11/h7,9H,3-6,8,10H2,1-2H3/b11-7-,12-9+.
What are the key properties of (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene?
(1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene has a molecular weight of 228.36 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,5E)-1-methyl-6-methylsulfonylcyclodeca-1,5-diene is sourced from PubChem (CID 126635593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).