C37H40N2O6+2 — CID 126635926
(1E,6E)-1,7-bis[3-methoxy-4-(3-pyridin-1-ium-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 126635926) has the molecular formula C37H40N2O6+2 and a molecular weight of 608.74 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[3-methoxy-4-(3-pyridin-1-ium-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[3-methoxy-4-(3-pyridin-1-ium-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 126635926 |
| Molecular Formula | C37H40N2O6+2 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | (1E,6E)-1,7-bis[3-methoxy-4-(3-pyridin-1-ium-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCCC[n+]3ccccc3)c(OC)c2)ccc1OCCC[n+]1ccccc1 |
| InChI | InChI=1S/C37H40N2O6/c1-42-36-27-30(13-17-34(36)44-25-9-23-38-19-5-3-6-20-38)11-15-32(40)29-33(41)16-12-31-14-18-35(37(28-31)43-2)45-26-10-24-39-21-7-4-8-22-39/h3-8,11-22,27-28H,9-10,23-26,29H2,1-2H3/q+2/b15-11+,16-12+ |
| InChIKey | ZXOOKRLFUHEBEZ-JOBJLJCHSA-N |
| XLogP | 5.47 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|