About 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete
2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete (PubChem CID 126635995) has the molecular formula C18H26N2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete.
Molecular Properties
| Compound Name | 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete |
| PubChem CID | 126635995 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete |
| SMILES | CCCCC1=CC=C(C2=NC(C3CCCCC3)=N2)CC1 |
| InChI | InChI=1S/C18H26N2/c1-2-3-7-14-10-12-16(13-11-14)18-19-17(20-18)15-8-5-4-6-9-15/h10,12,15H,2-9,11,13H2,1H3 |
| InChIKey | IERPLXUZIFKLDS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete?
The IUPAC name of 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete (CID 126635995) is 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete.
What is the SMILES notation for 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete?
The canonical SMILES for 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete is CCCCC1=CC=C(C2=NC(C3CCCCC3)=N2)CC1.
What is the InChIKey of 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete?
The InChIKey is IERPLXUZIFKLDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2/c1-2-3-7-14-10-12-16(13-11-14)18-19-17(20-18)15-8-5-4-6-9-15/h10,12,15H,2-9,11,13H2,1H3.
What are the key properties of 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete?
2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete has a molecular weight of 270.42 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-butylcyclohexa-1,3-dien-1-yl)-4-cyclohexyl-1,3-diazete is sourced from PubChem (CID 126635995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).