About N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine
N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine (PubChem CID 126636048) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine.
Molecular Properties
| Compound Name | N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine |
| PubChem CID | 126636048 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine |
| SMILES | CC1=CC=CCC1NCN |
| InChI | InChI=1S/C8H14N2/c1-7-4-2-3-5-8(7)10-6-9/h2-4,8,10H,5-6,9H2,1H3 |
| InChIKey | LYSWBWXDXHMZMZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine?
The IUPAC name of N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine (CID 126636048) is N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine.
What is the SMILES notation for N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine?
The canonical SMILES for N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine is CC1=CC=CCC1NCN.
What is the InChIKey of N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine?
The InChIKey is LYSWBWXDXHMZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-7-4-2-3-5-8(7)10-6-9/h2-4,8,10H,5-6,9H2,1H3.
What are the key properties of N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine?
N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine has a molecular weight of 138.21 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methylcyclohexa-2,4-dien-1-yl)methanediamine is sourced from PubChem (CID 126636048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).