About (6-bromocyclohexa-2,4-dien-1-yl)benzene
(6-bromocyclohexa-2,4-dien-1-yl)benzene (PubChem CID 126636127) has the molecular formula C12H11Br
and a molecular weight of 235.12 g/mol. Its IUPAC name is (6-bromocyclohexa-2,4-dien-1-yl)benzene.
Molecular Properties
| Compound Name | (6-bromocyclohexa-2,4-dien-1-yl)benzene |
| PubChem CID | 126636127 |
| Molecular Formula | C12H11Br |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | (6-bromocyclohexa-2,4-dien-1-yl)benzene |
| SMILES | BrC1C=CC=CC1c1ccccc1 |
| InChI | InChI=1S/C12H11Br/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,11-12H |
| InChIKey | ITGJLLSCTVVOIP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (6-bromocyclohexa-2,4-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromocyclohexa-2,4-dien-1-yl)benzene?
The IUPAC name of (6-bromocyclohexa-2,4-dien-1-yl)benzene (CID 126636127) is (6-bromocyclohexa-2,4-dien-1-yl)benzene.
What is the SMILES notation for (6-bromocyclohexa-2,4-dien-1-yl)benzene?
The canonical SMILES for (6-bromocyclohexa-2,4-dien-1-yl)benzene is BrC1C=CC=CC1c1ccccc1.
What is the InChIKey of (6-bromocyclohexa-2,4-dien-1-yl)benzene?
The InChIKey is ITGJLLSCTVVOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Br/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,11-12H.
What are the key properties of (6-bromocyclohexa-2,4-dien-1-yl)benzene?
(6-bromocyclohexa-2,4-dien-1-yl)benzene has a molecular weight of 235.12 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromocyclohexa-2,4-dien-1-yl)benzene is sourced from PubChem (CID 126636127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).