C13H25NO — CID 126636140
N-(2,3-dimethylbutan-2-yl)cyclohexanecarboxamide (PubChem CID 126636140) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N-(2,3-dimethylbutan-2-yl)cyclohexanecarboxamide.
| Compound Name | N-(2,3-dimethylbutan-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 126636140 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-(2,3-dimethylbutan-2-yl)cyclohexanecarboxamide |
| SMILES | CC(C)C(C)(C)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H25NO/c1-10(2)13(3,4)14-12(15)11-8-6-5-7-9-11/h10-11H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | FAIJYDYWBKKRDI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |