About N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine
N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine (PubChem CID 126636256) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine.
Molecular Properties
| Compound Name | N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine |
| PubChem CID | 126636256 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine |
| SMILES | C=NC1=C(/C=C\C)CCC=C1 |
| InChI | InChI=1S/C10H13N/c1-3-6-9-7-4-5-8-10(9)11-2/h3,5-6,8H,2,4,7H2,1H3/b6-3- |
| InChIKey | WJKNPRBKERMORD-UTCJRWHESA-N |
| XLogP | 2.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine?
The IUPAC name of N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine (CID 126636256) is N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine.
What is the SMILES notation for N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine?
The canonical SMILES for N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine is C=NC1=C(/C=C\C)CCC=C1.
What is the InChIKey of N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine?
The InChIKey is WJKNPRBKERMORD-UTCJRWHESA-N. The full InChI is InChI=1S/C10H13N/c1-3-6-9-7-4-5-8-10(9)11-2/h3,5-6,8H,2,4,7H2,1H3/b6-3-.
What are the key properties of N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine?
N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine has a molecular weight of 147.22 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine is sourced from PubChem (CID 126636256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).