C17H28N2 — CID 126636351
(E)-N,N,3-trimethyl-4-[(2Z)-4-methylpenta-2,4-dien-2-yl]imino-2-[(Z)-prop-1-enyl]pent-2-en-1-amine (PubChem CID 126636351) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (E)-N,N,3-trimethyl-4-[(2Z)-4-methylpenta-2,4-dien-2-yl]imino-2-[(Z)-prop-1-enyl]pent-2-en-1-amine.
| Compound Name | (E)-N,N,3-trimethyl-4-[(2Z)-4-methylpenta-2,4-dien-2-yl]imino-2-[(Z)-prop-1-enyl]pent-2-en-1-amine |
|---|---|
| PubChem CID | 126636351 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (E)-N,N,3-trimethyl-4-[(2Z)-4-methylpenta-2,4-dien-2-yl]imino-2-[(Z)-prop-1-enyl]pent-2-en-1-amine |
| SMILES | C=C(C)/C=C(C)\N=C(C)\C(C)=C(/C=C\C)CN(C)C |
| InChI | InChI=1S/C17H28N2/c1-9-10-17(12-19(7)8)15(5)16(6)18-14(4)11-13(2)3/h9-11H,2,12H2,1,3-8H3/b10-9-,14-11-,17-15+,18-16+ |
| InChIKey | YYTLVWUSANNUEI-UQRDOISXSA-N |
| XLogP | 4.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|