About (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal
(2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal (PubChem CID 126636374) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal.
Molecular Properties
| Compound Name | (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal |
| PubChem CID | 126636374 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal |
| SMILES | CNC(/C=C\N(C)CCO)=C/C=O |
| InChI | InChI=1S/C9H16N2O2/c1-10-9(4-7-12)3-5-11(2)6-8-13/h3-5,7,10,13H,6,8H2,1-2H3/b5-3-,9-4+ |
| InChIKey | YRYQWJXNRHWMGA-LWUTYWFWSA-N |
| XLogP | -0.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal?
The IUPAC name of (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal (CID 126636374) is (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal.
What is the SMILES notation for (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal?
The canonical SMILES for (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal is CNC(/C=C\N(C)CCO)=C/C=O.
What is the InChIKey of (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal?
The InChIKey is YRYQWJXNRHWMGA-LWUTYWFWSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-10-9(4-7-12)3-5-11(2)6-8-13/h3-5,7,10,13H,6,8H2,1-2H3/b5-3-,9-4+.
What are the key properties of (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal?
(2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal has a molecular weight of 184.24 g/mol, XLogP of -0.27, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-5-[2-hydroxyethyl(methyl)amino]-3-(methylamino)penta-2,4-dienal is sourced from PubChem (CID 126636374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).