C22H30O7 — CID 126636601
(4E,5E,8S,9S,11Z,13R,14S)-4-[(2E)-2-ethoxy-4-hydroxypenta-2,4-dienylidene]-8,9-dihydroxy-13,14-dimethyl-1-oxacyclotetradeca-5,11-diene-2,10-dione (PubChem CID 126636601) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (4E,5E,8S,9S,11Z,13R,14S)-4-[(2E)-2-ethoxy-4-hydroxypenta-2,4-dienylidene]-8,9-dihydroxy-13,14-dimethyl-1-oxacyclotetradeca-5,11-diene-2,10-dione.
| Compound Name | (4E,5E,8S,9S,11Z,13R,14S)-4-[(2E)-2-ethoxy-4-hydroxypenta-2,4-dienylidene]-8,9-dihydroxy-13,14-dimethyl-1-oxacyclotetradeca-5,11-diene-2,10-dione |
|---|---|
| PubChem CID | 126636601 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (4E,5E,8S,9S,11Z,13R,14S)-4-[(2E)-2-ethoxy-4-hydroxypenta-2,4-dienylidene]-8,9-dihydroxy-13,14-dimethyl-1-oxacyclotetradeca-5,11-diene-2,10-dione |
| SMILES | C=C(O)/C=C(\C=C1\C=C\C[C@H](O)[C@H](O)C(=O)/C=C\[C@@H](C)[C@H](C)OC(=O)C1)OCC |
| InChI | InChI=1S/C22H30O7/c1-5-28-18(11-15(3)23)12-17-7-6-8-19(24)22(27)20(25)10-9-14(2)16(4)29-21(26)13-17/h6-7,9-12,14,16,19,22-24,27H,3,5,8,13H2,1-2,4H3/b7-6+,10-9-,17-12-,18-11+/t14-,16+,19+,22+/m1/s1 |
| InChIKey | LCZIHQBWNFZNNS-GIEPTURLSA-N |
| XLogP | 2.67 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|